N-[(2-nitrophenyl)methyl]cyclopentanamine structure
|
Common Name | N-[(2-nitrophenyl)methyl]cyclopentanamine | ||
|---|---|---|---|---|
| CAS Number | 355814-64-1 | Molecular Weight | 220.26800 | |
| Density | 1.15g/cm3 | Boiling Point | 340.2ºC at 760 mmHg | |
| Molecular Formula | C12H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.5ºC | |
| Name | N-[(2-nitrophenyl)methyl]cyclopentanamine |
|---|
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 340.2ºC at 760 mmHg |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.26800 |
| Flash Point | 159.5ºC |
| Exact Mass | 220.12100 |
| PSA | 57.85000 |
| LogP | 3.54110 |
| Index of Refraction | 1.567 |
| InChIKey | JMTSOBGTJCORHV-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1CNC1CCCC1 |
| HS Code | 2921499090 |
|---|
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |