tetrafluorosuccinyl structure
|
Common Name | tetrafluorosuccinyl | ||
|---|---|---|---|---|
| CAS Number | 356-15-0 | Molecular Weight | 226.94100 | |
| Density | 1.7g/cm3 | Boiling Point | 120.1ºC at 760mmHg | |
| Molecular Formula | C4Cl2F4O2 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 26.4ºC | |
| Name | Tetrafluorosuccinyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7g/cm3 |
|---|---|
| Boiling Point | 120.1ºC at 760mmHg |
| Molecular Formula | C4Cl2F4O2 |
| Molecular Weight | 226.94100 |
| Flash Point | 26.4ºC |
| Exact Mass | 225.92100 |
| PSA | 34.14000 |
| LogP | 1.78780 |
| Index of Refraction | 1.38 |
| InChIKey | XCSFZFHJQXODPO-UHFFFAOYSA-N |
| SMILES | O=C(Cl)C(F)(F)C(F)(F)C(=O)Cl |
| Hazard Codes | C: Corrosive; |
|---|---|
| Risk Phrases | 34 |
| Safety Phrases | 26-36/37/39 |
| RIDADR | UN 3265 |
| HS Code | 2917190090 |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| EINECS 206-598-1 |
| MFCD00013653 |
| 2,2,3,3-tetrafluorobutanedioyl dichloride |