Butanediamide,2,2,3,3-tetrafluoro structure
|
Common Name | Butanediamide,2,2,3,3-tetrafluoro | ||
|---|---|---|---|---|
| CAS Number | 377-37-7 | Molecular Weight | 188.08000 | |
| Density | 1.593 g/cm3 | Boiling Point | 449ºC at 760 mmHg | |
| Molecular Formula | C4H4F4N2O2 | Melting Point | 259 °C | |
| MSDS | N/A | Flash Point | 225.3ºC | |
| Name | Tetrafluorosuccinamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.593 g/cm3 |
|---|---|
| Boiling Point | 449ºC at 760 mmHg |
| Melting Point | 259 °C |
| Molecular Formula | C4H4F4N2O2 |
| Molecular Weight | 188.08000 |
| Flash Point | 225.3ºC |
| Exact Mass | 188.02100 |
| PSA | 86.18000 |
| LogP | 0.62820 |
| Index of Refraction | 1.394 |
| InChIKey | MYWRUVWOYAPWLT-UHFFFAOYSA-N |
| SMILES | NC(=O)C(F)(F)C(F)(F)C(N)=O |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2924199090 |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| tetrafluorosuccinamide |
| MFCD00039772 |
| 2,2,3,3-tetrafluoro-succinamide |