1-Butanol,1-ethoxy-2,2,3,3,4,4,4-heptafluoro-
Modify Date: 2025-09-22 12:49:49
1-Butanol,1-ethoxy-2,2,3,3,4,4,4-heptafluoro- structure
|
Common Name | 1-Butanol,1-ethoxy-2,2,3,3,4,4,4-heptafluoro- | ||
|---|---|---|---|---|
| CAS Number | 356-26-3 | Molecular Weight | 244.10700 | |
| Density | 1.435g/cm3 | Boiling Point | 104.1ºC at 760mmHg | |
| Molecular Formula | C6H7F7O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 55.8ºC | |
| Name | 1-ethoxy-2,2,3,3,4,4,4-heptafluorobutan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.435g/cm3 |
|---|---|
| Boiling Point | 104.1ºC at 760mmHg |
| Molecular Formula | C6H7F7O2 |
| Molecular Weight | 244.10700 |
| Flash Point | 55.8ºC |
| Exact Mass | 244.03300 |
| PSA | 29.46000 |
| LogP | 2.17420 |
| Index of Refraction | 1.324 |
| InChIKey | NPUHUJNJOILQJC-UHFFFAOYSA-N |
| SMILES | CCOC(O)C(F)(F)C(F)(F)C(F)(F)F |
| HS Code | 2911000000 |
|---|
|
~%
1-Butanol,1-eth... CAS#:356-26-3 |
| Literature: Minnesota Mining and Mfg.Co. Patent: US2681370 , 1952 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2911000000 |
|---|---|
| Summary | 2911000000 acetals and hemiacetals, whether or not with other oxygen function, and their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| EINECS 206-601-6 |
| heptafluorobutyraldehyde ethyl hemiacetal |
| 1-ethoxy-1H-heptafluoro-butan-1-ol |
| Heptafluorobutyl butyraldehyde,ethyl hemiacetal |
| 1-Aethoxy-1H-heptafluor-butan-1-ol |