Azido-PEG5-azide structure
|
Common Name | Azido-PEG5-azide | ||
|---|---|---|---|---|
| CAS Number | 356046-26-9 | Molecular Weight | 332.35600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H24N6O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Azido-PEG5-azideAzido-PEG5-azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 1-azido-2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethane |
|---|---|
| Synonym | More Synonyms |
| Description | Azido-PEG5-azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C12H24N6O5 |
|---|---|
| Molecular Weight | 332.35600 |
| Exact Mass | 332.18100 |
| PSA | 145.65000 |
| LogP | 0.59552 |
| InChIKey | OQHIMLOZSDFRID-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCOCCOCCN=[N+]=[N-] |
| bisazido hexaethylene glycol |
| 3,6,9,12,15-Pentaoxaheptadecane-1,17-diyl Bis-azide |
| Azido-PEG5-Azide |
| 1,17-DIAZIDO-3,6,9,12,15-PENTAOXAHEPTADECANE |