phenyl 4-(diaminomethylideneamino)benzoate structure
|
Common Name | phenyl 4-(diaminomethylideneamino)benzoate | ||
|---|---|---|---|---|
| CAS Number | 35695-21-7 | Molecular Weight | 255.27200 | |
| Density | 1.25g/cm3 | Boiling Point | 480.9ºC at 760 mmHg | |
| Molecular Formula | C14H13N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244.6ºC | |
| Name | phenyl 4-(diaminomethylideneamino)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 480.9ºC at 760 mmHg |
| Molecular Formula | C14H13N3O2 |
| Molecular Weight | 255.27200 |
| Flash Point | 244.6ºC |
| Exact Mass | 255.10100 |
| PSA | 88.20000 |
| LogP | 3.08420 |
| Index of Refraction | 1.617 |
| InChIKey | PXPIXLVXGYQMFM-UHFFFAOYSA-N |
| SMILES | NC(N)=Nc1ccc(C(=O)Oc2ccccc2)cc1 |
| HS Code | 2925290090 |
|---|
|
~32%
phenyl 4-(diami... CAS#:35695-21-7 |
| Literature: Kaminski, J. M.; Bauer, L.; Mack, S. R.; Anderson, R. A.; Waller, D. P.; Zaneveld, L. J. D. Journal of Medicinal Chemistry, 1986 , vol. 29, # 4 p. 514 - 519 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4-Guanidino-benzoic acid phenyl ester |
| Phenyl 4-guanidinobenzoate |
| Phenyl-4-guanidinobenzoat |
| 4-Guanidinobenzoesaeurephenylester |