1,1,2,3,3,3-Hexafluoropropoxybenzene
1,1,2,3,3,3-Hexafluoropropoxybenzene structure
|
Common Name | 1,1,2,3,3,3-Hexafluoropropoxybenzene | ||
|---|---|---|---|---|
| CAS Number | 357-98-2 | Molecular Weight | 244.13400 | |
| Density | 1.359 g/cm3 | Boiling Point | 79-81ºC 51mm | |
| Molecular Formula | C9H6F6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 55.9ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,1,2,3,3,3-Hexafluoropropoxybenzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.359 g/cm3 |
|---|---|
| Boiling Point | 79-81ºC 51mm |
| Molecular Formula | C9H6F6O |
| Molecular Weight | 244.13400 |
| Flash Point | 55.9ºC |
| Exact Mass | 244.03200 |
| PSA | 9.23000 |
| LogP | 3.55860 |
| InChIKey | UOIMAHYTZWHKGZ-UHFFFAOYSA-N |
| SMILES | FC(C(F)(F)F)C(F)(F)Oc1ccccc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2909309090 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 0 | |
CAS#:116-15-4
CAS#:108-95-2
CAS#:661-95-0
CAS#:100-67-4This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,1,2,3,3,3-hexafluoropropoxybenzene |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1,1,2,3,3,3-Hexafluoropropoxybenzene? |
| A: Molecular weight of 1,1,2,3,3,3-Hexafluoropropoxybenzene is 244.13400. |
| Q: What is the molecular formula of 1,1,2,3,3,3-Hexafluoropropoxybenzene? |
| A: Molecular formula of 1,1,2,3,3,3-Hexafluoropropoxybenzene is C9H6F6O. |
| Q: What is the safety information for 1,1,2,3,3,3-Hexafluoropropoxybenzene? |
| A: Safety information for 1,1,2,3,3,3-Hexafluoropropoxybenzene: 26-36/37/39. |
| Q: What is the InChIKey of 1,1,2,3,3,3-Hexafluoropropoxybenzene? |
| A: InChIKey of 1,1,2,3,3,3-Hexafluoropropoxybenzene is UOIMAHYTZWHKGZ-UHFFFAOYSA-N. |
| Q: What is the LogP of 1,1,2,3,3,3-Hexafluoropropoxybenzene? |
| A: LogP of 1,1,2,3,3,3-Hexafluoropropoxybenzene is 3.55860. |
| Q: What English synonyms does 1,1,2,3,3,3-Hexafluoropropoxybenzene have? |
| A: English synonyms of 1,1,2,3,3,3-Hexafluoropropoxybenzene: 1,1,2,3,3,3-hexafluoropropoxybenzene. |
| Q: What is the English name of 1,1,2,3,3,3-Hexafluoropropoxybenzene? |
| A: The English name of 1,1,2,3,3,3-Hexafluoropropoxybenzene is 1,1,2,3,3,3-Hexafluoropropoxybenzene. |
| Q: What is the CAS number of 1,1,2,3,3,3-Hexafluoropropoxybenzene? |
| A: CAS number of 1,1,2,3,3,3-Hexafluoropropoxybenzene is 357-98-2. |
| Q: What is the SMILES notation of 1,1,2,3,3,3-Hexafluoropropoxybenzene? |
| A: SMILES notation of 1,1,2,3,3,3-Hexafluoropropoxybenzene is FC(C(F)(F)F)C(F)(F)Oc1ccccc1. |
| Q: What are the upstream materials of 1,1,2,3,3,3-Hexafluoropropoxybenzene? |
| A: Related upstream materials(CAS) of 1,1,2,3,3,3-Hexafluoropropoxybenzene: 116-15-4;108-95-2;661-95-0;100-67-4. |