1-(4-methylsulfanylphenyl)-2-(4-nitrophenyl)ethanol structure
|
Common Name | 1-(4-methylsulfanylphenyl)-2-(4-nitrophenyl)ethanol | ||
|---|---|---|---|---|
| CAS Number | 35717-60-3 | Molecular Weight | 289.35000 | |
| Density | 1.29g/cm3 | Boiling Point | 460.5ºC at 760 mmHg | |
| Molecular Formula | C15H15NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.3ºC | |
| Name | 1-(4-methylsulfanylphenyl)-2-(4-nitrophenyl)ethanol |
|---|
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 460.5ºC at 760 mmHg |
| Molecular Formula | C15H15NO3S |
| Molecular Weight | 289.35000 |
| Flash Point | 232.3ºC |
| Exact Mass | 289.07700 |
| PSA | 91.35000 |
| LogP | 4.11600 |
| Index of Refraction | 1.646 |
| InChIKey | CPRBFIMOFKNHLQ-UHFFFAOYSA-N |
| SMILES | CSc1ccc(C(O)Cc2ccc([N+](=O)[O-])cc2)cc1 |
|
~%
1-(4-methylsulf... CAS#:35717-60-3 |
| Literature: Fletcher; Namkung; Pan; Cole Journal of medicinal chemistry, 1971 , vol. 14, # 11 p. 1113 - 1115 |
|
~%
1-(4-methylsulf... CAS#:35717-60-3 |
| Literature: Fletcher; Namkung; Pan; Cole Journal of medicinal chemistry, 1971 , vol. 14, # 11 p. 1113 - 1115 |