Tris(2,2,2-trifluoroethyl) phosphate structure
|
Common Name | Tris(2,2,2-trifluoroethyl) phosphate | ||
|---|---|---|---|---|
| CAS Number | 358-63-4 | Molecular Weight | 344.069 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 176.2±40.0 °C at 760 mmHg | |
| Molecular Formula | C6H6F9O4P | Melting Point | -22℃ | |
| MSDS | N/A | Flash Point | 60.4±27.3 °C | |
| Name | tris(2,2,2-trifluoroethyl) phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 176.2±40.0 °C at 760 mmHg |
| Melting Point | -22℃ |
| Molecular Formula | C6H6F9O4P |
| Molecular Weight | 344.069 |
| Flash Point | 60.4±27.3 °C |
| Exact Mass | 343.985992 |
| PSA | 54.57000 |
| LogP | 3.39 |
| Vapour Pressure | 1.5±0.3 mmHg at 25°C |
| Index of Refraction | 1.317 |
| InChIKey | ZMQDTYVODWKHNT-UHFFFAOYSA-N |
| SMILES | O=P(OCC(F)(F)F)(OCC(F)(F)F)OCC(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| RIDADR | 3272 |
| Packaging Group | III |
| HS Code | 2919900090 |
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| Tris(2,2,2-trifluoroethyl) phosphate |