GKK1032B structure
|
Common Name | GKK1032B | ||
|---|---|---|---|---|
| CAS Number | 358375-11-8 | Molecular Weight | 501.656 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 653.9±55.0 °C at 760 mmHg | |
| Molecular Formula | C32H39NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 349.3±31.5 °C | |
Use of GKK1032BGKK1032B is an alkaloid compound that can be found in endophytic fungus Penicillium sp. GKK1032B can induce the apoptosis of human osteosarcoma MG63 cells through caspase pathway activation[1]. |
| Name | GKK1032B |
|---|---|
| Synonym | More Synonyms |
| Description | GKK1032B is an alkaloid compound that can be found in endophytic fungus Penicillium sp. GKK1032B can induce the apoptosis of human osteosarcoma MG63 cells through caspase pathway activation[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 653.9±55.0 °C at 760 mmHg |
| Molecular Formula | C32H39NO4 |
| Molecular Weight | 501.656 |
| Flash Point | 349.3±31.5 °C |
| Exact Mass | 501.287903 |
| LogP | 7.78 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.560 |
| InChIKey | GAPPHVJLWSRLAC-ZABYPXOYSA-N |
| SMILES | C=CC1(C)C=C(C)C2C3C(Oc4ccc(cc4)CC4C(=O)NC(=O)C4C(=O)C31)C1C(C)CC(C)CC21C |
| 5,8-Ethenofluoreno[9',1':2,3,4]oxacyclododecino[6,7-c]pyrrole-1,3,17(2H,4H,10H)-trione, 16-ethenyl-3a,9a,9b,11,12,13,13a,13b,16,16a,16b,17a-dodecahydro-10,12,13a,14,16-pentamethyl-, (3aS,9aS,9bR,10S,12R,13aS,13bS,16S,16aR,16bS,17aR)- |
| GKK1032B |
| (3S,4R,5S,7R,9S,10S,13S,14R,16R,20S,27S)-5,7,9,11,13-Pentamethyl-13-vinyl-2-oxa-18-azahexacyclo[20.2.2.13,10.04,9.014,27.016,20]heptacosa-1(24),11,22,25-tetraene-15,17,19-trione |