4-chloro-2-(trichloromethyl)quinoline
Modify Date: 2025-09-18 13:52:18
4-chloro-2-(trichloromethyl)quinoline structure
|
Common Name | 4-chloro-2-(trichloromethyl)quinoline | ||
|---|---|---|---|---|
| CAS Number | 35871-17-1 | Molecular Weight | 280.96500 | |
| Density | 1.56g/cm3 | Boiling Point | 331.9ºC at 760 mmHg | |
| Molecular Formula | C10H5Cl4N | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 184.7ºC | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | 4-chloro-2-(trichloromethyl)quinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.56g/cm3 |
|---|---|
| Boiling Point | 331.9ºC at 760 mmHg |
| Molecular Formula | C10H5Cl4N |
| Molecular Weight | 280.96500 |
| Flash Point | 184.7ºC |
| Exact Mass | 278.91800 |
| PSA | 12.89000 |
| LogP | 4.71490 |
| Index of Refraction | 1.655 |
| InChIKey | AAAIMZMBCBBTQL-UHFFFAOYSA-N |
| SMILES | Clc1cc(C(Cl)(Cl)Cl)nc2ccccc12 |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301 |
| Precautionary Statements | P301 + P310 |
| RIDADR | UN 2811 6.1 / PGIII |
| HS Code | 2933499090 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Aberrant connexin26 hemichannels underlying keratitis-ichthyosis-deafness syndrome are potently inhibited by mefloquine.
J. Invest. Dermatol. 135(4) , 1033-42, (2015) Keratitis-ichthyosis-deafness (KID) syndrome is an ectodermal dysplasia caused by dominant mutations of connexin26 (Cx26). Loss of Cx26 function causes nonsyndromic sensorineural deafness, without con... |
| 4-Chloro-2-trichloromethylquinoline |
| QU022 |
| 4-Chlor-2-trichlormethylchinolin |