Tris(pentafluoroethyl)amine structure
|
Common Name | Tris(pentafluoroethyl)amine | ||
|---|---|---|---|---|
| CAS Number | 359-70-6 | Molecular Weight | 371.047 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 70.3±35.0 °C at 760 mmHg | |
| Molecular Formula | C6F15N | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | -3.7±25.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Perfluorotriethylamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 70.3±35.0 °C at 760 mmHg |
| Molecular Formula | C6F15N |
| Molecular Weight | 371.047 |
| Flash Point | -3.7±25.9 °C |
| Exact Mass | 370.979126 |
| PSA | 3.24000 |
| LogP | 12.72 |
| Vapour Pressure | 129.7±0.1 mmHg at 25°C |
| Index of Refraction | 1.262 |
| InChIKey | CBEFDCMSEZEGCX-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)N(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | KH2155170 |
| HS Code | 2921199090 |
| Precursor 10 | |
|---|---|
| DownStream 2 | |
| HS Code | 2921199090 |
|---|---|
| Summary | 2921199090 other acyclic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Organic reactions without an organic medium. Utilization of perfluorotriethylamine as a reaction medium. Nakano H and Kitazume T.
Green Chem. 1(1) , 21-22, (1999)
|
|
|
Thermal decomposition of halon alternatives. Yamamoto T, et al.
Chemosphere 35(3) , 643-54, (1997)
|
|
|
The behavior of bubbles in perfluorotriethylamine under the effect of strong electric fields. Korobeinikov SM, et al.
High Temp. 39(6) , 821-25, (2001)
|
| MFCD00166270 |
| 1,1,2,2,2-pentafluoro-N,N-bis(1,1,2,2,2-pentafluoroethyl)ethanamine |
| 1,1,2,2,2-Pentafluoro-N,N-bis(pentafluoroethyl)ethanamine |
| EINECS 206-632-5 |
| Ethanamine, 1,1,2,2,2-pentafluoro-N,N-bis(1,1,2,2,2-pentafluoroethyl)- |