s-triazine, 2,4,6-tris(pentafluoroethyl)- structure
|
Common Name | s-triazine, 2,4,6-tris(pentafluoroethyl)- | ||
|---|---|---|---|---|
| CAS Number | 858-46-8 | Molecular Weight | 435.092 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 197.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C9F15N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 73.1±30.1 °C | |
| Name | 2,4,6-tris(1,1,2,2,2-pentafluoroethyl)-1,3,5-triazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 197.2±50.0 °C at 760 mmHg |
| Molecular Formula | C9F15N3 |
| Molecular Weight | 435.092 |
| Flash Point | 73.1±30.1 °C |
| Exact Mass | 434.985260 |
| PSA | 38.67000 |
| LogP | 9.30 |
| Vapour Pressure | 0.5±0.4 mmHg at 25°C |
| Index of Refraction | 1.322 |
| InChIKey | MQBPAXAOMVELQG-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)c1nc(C(F)(F)C(F)(F)F)nc(C(F)(F)C(F)(F)F)n1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xn: Harmful;Xi: Irritant; |
|---|---|
| Risk Phrases | 20 |
| Safety Phrases | S23-S24/25 |
| WGK Germany | 3 |
| HS Code | 2933699090 |
|
~%
s-triazine, 2,4... CAS#:858-46-8 |
| Literature: Journal of Organic Chemistry, , vol. 22, p. 698 |
|
~%
s-triazine, 2,4... CAS#:858-46-8 |
| Literature: Journal of Organic Chemistry, , vol. 22, p. 698 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 2,4,6-Tris(pentafluoroethyl)-1,3,5-triazine |
| s-triazine, 2,4,6-tris(pentafluoroethyl)- |
| 2,4,6-Tris-pentafluoraethyl-1,3,5-triazin |
| EINECS 212-724-6 |
| 1,3,5-Triazine, 2,4,6-tris(1,1,2,2,2-pentafluoroethyl)- |
| 2,4,6-Tri-pentafluorethyl-triazin |
| MFCD00042437 |
| Tris-pentafluoraethyl-s-triazin |
| 1,3,5-Triazine, 2,4,6-tris(pentafluoroethyl)- |