CHEMBRDG-BB 5845123 structure
|
Common Name | CHEMBRDG-BB 5845123 | ||
|---|---|---|---|---|
| CAS Number | 359810-48-3 | Molecular Weight | 265.10300 | |
| Density | 1.459g/cm3 | Boiling Point | 367.2ºC at 760 mmHg | |
| Molecular Formula | C12H9BrO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.9ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 5-(2-bromo-4-methylphenyl)furan-2-carbaldehyde |
|---|
| Density | 1.459g/cm3 |
|---|---|
| Boiling Point | 367.2ºC at 760 mmHg |
| Molecular Formula | C12H9BrO2 |
| Molecular Weight | 265.10300 |
| Flash Point | 175.9ºC |
| Exact Mass | 263.97900 |
| PSA | 30.21000 |
| LogP | 3.83000 |
| Index of Refraction | 1.603 |
| InChIKey | JRJUEVPOZMWWNK-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2ccc(C=O)o2)c(Br)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H319 |
| Precautionary Statements | P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2932190090 |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |