Amiprofos methyl structure
|
Common Name | Amiprofos methyl | ||
|---|---|---|---|---|
| CAS Number | 36001-88-4 | Molecular Weight | 304.30 | |
| Density | 1.275g/cm3 | Boiling Point | 389.9ºC at 760mmHg | |
| Molecular Formula | C11H17N2O4PS | Melting Point | -65ºC | |
| MSDS | Chinese USA | Flash Point | 189.6ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of Amiprofos methylAmiprofos methyl (BAY-NTN 6867) is a phosphoric amide herbicide. Amiprofos methyl is a specific and potent antimicrotubule agent. Amiprofos methyl directly poisons microtubule dynamics in plant cells[1]. |
| Name | amiprofos-methyl |
|---|---|
| Synonym | More Synonyms |
| Description | Amiprofos methyl (BAY-NTN 6867) is a phosphoric amide herbicide. Amiprofos methyl is a specific and potent antimicrotubule agent. Amiprofos methyl directly poisons microtubule dynamics in plant cells[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amiprofos methyl (APM) inhibits competitively the binding of [14C]oryzalin to tubulin with a Ki=5 μM. Amiprofos methyl concentrations inhibiting tobacco cell growth were within the threshold range of Amiprofos methyl concentrations that depolymerized cellular microtubules, indicating that growth inhibition is caused by microtubules depolymerization[2]. |
| References |
| Density | 1.275g/cm3 |
|---|---|
| Boiling Point | 389.9ºC at 760mmHg |
| Melting Point | -65ºC |
| Molecular Formula | C11H17N2O4PS |
| Molecular Weight | 304.30 |
| Flash Point | 189.6ºC |
| Exact Mass | 304.06500 |
| PSA | 118.21000 |
| LogP | 4.71560 |
| Index of Refraction | 1.553 |
| InChIKey | VHEWQRWLIDWRMR-UHFFFAOYSA-N |
| SMILES | COP(=S)(NC(C)C)Oc1ccc(C)cc1[N+](=O)[O-] |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R22 |
| Safety Phrases | 36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | TB5100000 |
| HS Code | 2929909011 |
| HS Code | 2929909011 |
|---|---|
| Summary | 2929909011 o-methyl o-(4-methyl-2-nitrophenyl) isopropylphosphoramidothioate |
|
Blockage of mitosis in maize root tips using colchicine-alternatives.
Protoplasma 241(1-4) , 99-104, (2010) Mitosis in plants can be blocked by colchicine which has the capacity to bind microtubule subunits. In maize (Zea mays L.) breeding, it is frequently being used for doubling chromosome numbers of hapl... |
|
|
In vivo dynamics and differential microtubule-binding activities of MAP65 proteins.
Plant Physiol. 136(4) , 3956-67, (2004) Plant cells produce different microtubule arrays that are essential for cell division and morphogenesis without equivalent in other eukaryotes. Microtubule-associated proteins influence the behavior o... |
|
|
Microtubule distribution in gravitropic protonemata of the moss Ceratodon.
Protoplasma 159 , 60-9, (1990) Tip cells of dark-grown protonemata of the moss Ceratodon purpureus are negatively gravitropic (grow upward). They possess a unique longitudinal zonation: (1) a tip group of amylochloroplasts in the a... |
| O-methyl O-(4-methyl-2-nitrophenyl) N-(1-methylethyl)phosphoramidothioate |
| Amiprofos methyl |
| (RS)-(O-methyl O-2-nitro-p-tolyl isopropylphosphoramidothioate) |
| (Ξ)-[O-methyl O-(4-methyl-2-nitrophenyl) propan-2-ylphosphoramidothioate] |
| O-Methyl O-(2-nitro-p-tolyl) N-isopropylphosphoramidothionate |
| N-[methoxy-(4-methyl-2-nitrophenoxy)phosphinothioyl]propan-2-amine |
| amiprophos-methyl |