(3-Bromopropyl)(triphenyl)phosphonium bromide structure
|
Common Name | (3-Bromopropyl)(triphenyl)phosphonium bromide | ||
|---|---|---|---|---|
| CAS Number | 3607-17-8 | Molecular Weight | 464.173 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H21Br2P | Melting Point | 228-230 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (3-Bromopropyl)Triphenylphosphonium Bromide |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 228-230 °C(lit.) |
|---|---|
| Molecular Formula | C21H21Br2P |
| Molecular Weight | 464.173 |
| Exact Mass | 461.974762 |
| PSA | 13.59000 |
| LogP | 1.76950 |
| InChIKey | ZAHUZZUGJRPGKW-UHFFFAOYSA-M |
| SMILES | BrCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2931900090 |
|
~87%
(3-Bromopropyl)... CAS#:3607-17-8 |
| Literature: Siriwardana, Amal I.; Nakamura, Itaru; Yamamoto, Yoshinori Tetrahedron Letters, 2003 , vol. 44, # 24 p. 4547 - 4550 |
|
~%
(3-Bromopropyl)... CAS#:3607-17-8 |
| Literature: Organic and Biomolecular Chemistry, , vol. 4, # 23 p. 4345 - 4351 |
| Precursor 3 | |
|---|---|
| DownStream 10 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|
Structure of antischistosome compounds. IV. (3-Bromopropyl)triphenylphosphonium bromide.
Acta Crystallogr. C 44 ( Pt 10) , 1862-4, (1988) C21H21BrP+.Br-, Mr = 464.2, monoclinic, P2(1)/c, a = 11.165(2), b = 10.160(2), c = 17.614(3)A, beta = 104.99(1) degree, V = 1930.08 A3, Z = 4, Dx = 1.597 g cm-3, graphite-monochromatized Cu K alpha ra... |
| 3-bromopropyl(triphenyl)phosphanium,bromide |
| MFCD00011866 |
| (3-Bromopropyl)triphenylphosphonium bromide |
| Phosphonium, (3-bromopropyl)triphenyl-, bromide |
| 3-Bromopropyltriphenylphosphonium Bromide |
| (3-Bromopropyl)(triphenyl)phosphonium bromide |
| (3-BROMO-PROPYL)-TRIPHENYL-PHOSPHONIUM,BROMIDE |
| Phosphonium, (3-bromopropyl)triphenyl-, bromide (1:1) |
| EINECS 222-770-9 |