Cyclopropyltriphenylphosphonium bromide structure
|
Common Name | Cyclopropyltriphenylphosphonium bromide | ||
|---|---|---|---|---|
| CAS Number | 14114-05-7 | Molecular Weight | 383.261 | |
| Density | N/A | Boiling Point | 292.7±25.0 °C(Predicted) | |
| Molecular Formula | C21H20BrP | Melting Point | 178-181 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | cyclopropyltriphenylphosphonium bromide |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 292.7±25.0 °C(Predicted) |
|---|---|
| Melting Point | 178-181 °C(lit.) |
| Molecular Formula | C21H20BrP |
| Molecular Weight | 383.261 |
| Exact Mass | 382.048584 |
| PSA | 13.59000 |
| LogP | 1.14690 |
| InChIKey | XMPWFKHMCNRJCL-UHFFFAOYSA-M |
| SMILES | [Br-].c1ccc([P+](c2ccccc2)(c2ccccc2)C2CC2)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R20/21 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2931900090 |
|
~91%
Cyclopropyltrip... CAS#:14114-05-7 |
| Literature: Maercker, Adalbert; Daub, Volker E. E. Tetrahedron, 1994 , vol. 50, # 8 p. 2439 - 2458 |
|
~36%
Cyclopropyltrip... CAS#:14114-05-7 |
| Literature: Celebi, Sol; Leyva, Soccoro; Modarelli, David A.; Platz, Matthew S. Journal of the American Chemical Society, 1993 , vol. 115, # 19 p. 8613 - 8620 |
|
~%
Cyclopropyltrip... CAS#:14114-05-7 |
| Literature: Tetrahedron, , vol. 29, p. 1169 - 1171 |
|
~%
Cyclopropyltrip... CAS#:14114-05-7 |
| Literature: Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), , p. 304 - 311 |
| Precursor 4 | |
|---|---|
| DownStream 10 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Cyclopropyltriphenylphosphonium bromide |
| Phosphonium, cyclopropyltriphenyl-, bromide (1:1) |
| EINECS 237-970-1 |
| Phosphonium, cyclopropyltriphenyl-, bromide |
| cyclopropyl(triphenyl)phosphanium,bromide |
| MFCD00011872 |
| Cyclopropyl(triphenyl)phosphonium bromide |