Bucladesine structure
|
Common Name | Bucladesine | ||
|---|---|---|---|---|
| CAS Number | 362-74-3 | Molecular Weight | 469.386 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C18H24N5O8P | Melting Point | 203 - 205 °C | |
| MSDS | N/A | Flash Point | N/A | |
Use of BucladesineBucladesine is a cyclic nucleotide derivative which mimics the action of endogenous cAMP and is capable of permeating the cell membrane. It has vasodilator properties and is used as a cardiac stimulant. Bucladesine is a phosphodiesterase inhibitor. Bucladesine is a cell permeable cAMP analog. The compound is used in a wide variety of research applications because it mimics cAMP and can induce normal physiological responses when added to cells in experimental conditions. cAMP is only able to elicit minimal responses in these situations. The neurite outgrowth instigated by bucladesine in cell cultures has been shown to be enhanced by nardosinone. |
| Name | Bucladesine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Melting Point | 203 - 205 °C |
| Molecular Formula | C18H24N5O8P |
| Molecular Weight | 469.386 |
| Exact Mass | 469.136261 |
| PSA | 173.80000 |
| LogP | 1.76300 |
| Index of Refraction | 1.717 |
| InChIKey | CJGYSWNGNKCJSB-YVLZZHOMSA-N |
| SMILES | CCCC(=O)Nc1ncnc2c1ncn2C1OC2COP(=O)(O)OC2C1OC(=O)CCC |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATAMUTATION DATA
|
| dibutyryl cAMP |
| Bt2 cyclic AMP |
| (4aR,6R,7R,7aR)-6-[6-(butanoylamino)-9H-purin-9-yl]-2-hydroxy-2-oxidotetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-yl butanoate |
| 3',5'-Cyclic AMP dibutyrate |
| n-6,o-2'-dibutyryl adenosine cyclic 3':5'-monophosphate |
| Cyclic AMP dibutyrate |
| N-(9-b-D-Ribofuranosyl-9H-purin-6-yl)butyramide Cyclic 3',5'-(Hydrogen Phosphate) 2'-Butyrate |
| N6,2'-O-Dibutyryl cAMP |
| N6,2'-O-Dibutyryladenosine 3',5'-Cyclic Monophosphate |
| Butanoic acid, (4aR,6R,7R,7aR)-tetrahydro-2-hydroxy-2-oxido-6-[6-[(1-oxobutyl)amino]-9H-purin-9-yl]-4H-furo[3,2-d]-1,3,2-dioxaphosphorin-7-yl ester |
| N6,2'-O-dibutyryl-cAMP |
| Bucladesine |
| (4aR,6R,7R,7aR)-6-[6-(Butyrylamino)-9H-purin-9-yl]-2-hydroxy-2-oxidotetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-yl butyrate |
| Dibutyryl cyclic 3',5'-AMP |
| dibutyryl cyclic AMP |
| CalciuM Dibutyacyladenosine |
| N,O-dibutyryl cyclic AMP |
| N-(9-beta-D-Ribofuranosyl-9H-furin-6-yl)-butyramidecyclic3',5'-(hydrogenphosphate)2'-butyrate |
| N-(1-Oxobutyl)adenosine Cyclic 3',5'-(Hydrogen Phosphate) 2'-Butanoate |
| Dibutyryl-cAMP |
| Dibutyryl 3',5'-Cyclic AMP |