3-Chlorophenylmagnesium bromide structure
|
Common Name | 3-Chlorophenylmagnesium bromide | ||
|---|---|---|---|---|
| CAS Number | 36229-42-2 | Molecular Weight | 215.75800 | |
| Density | 0.960 g/mL at 25 °C(lit.) | Boiling Point | 65 °C(lit.) | |
| Molecular Formula | C6H4BrClMg | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 1 °F | |
| Name | magnesium,chlorobenzene,bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.960 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 65 °C(lit.) |
| Molecular Formula | C6H4BrClMg |
| Molecular Weight | 215.75800 |
| Flash Point | 1 °F |
| Exact Mass | 213.90400 |
| LogP | 2.98580 |
| InChIKey | ZMPYQGQHGLLBQI-UHFFFAOYSA-M |
| SMILES | Clc1c[c-]ccc1.[Br-].[Mg+2] |
| Storage condition | 2-8°C |
| Hazard Codes | F,C,F+ |
|---|---|
| Risk Phrases | R11 |
| Safety Phrases | 16-23-26-36/37/39-45 |
| RIDADR | UN 2924 3/PG 2 |
| WGK Germany | 1 |
| HS Code | 2931900090 |
|
~%
3-Chlorophenylm... CAS#:36229-42-2 |
| Literature: US6300499 B1, ; US 6300499 B1 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 3-Chlorophenylmagnesium bromide 0.5 M in Tetrahydrofuran |
| m-chlorophenylmagnesium bromide |
| 3-Chlorophenylmagnesium bromide |
| 2-chlorophenylmagnesium bromide |
| MFCD00672003 |
| 3-chlorophenyl magnesium bromide |