ETHYL 8-(4-BIPHENYL)-8-OXOOCTANOATE
Modify Date: 2025-09-16 12:06:25
ETHYL 8-(4-BIPHENYL)-8-OXOOCTANOATE structure
|
Common Name | ETHYL 8-(4-BIPHENYL)-8-OXOOCTANOATE | ||
|---|---|---|---|---|
| CAS Number | 362669-47-4 | Molecular Weight | 338.44000 | |
| Density | 1.052g/cm3 | Boiling Point | 473.666ºC at 760 mmHg | |
| Molecular Formula | C22H26O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.268ºC | |
| Name | ethyl 8-oxo-8-(4-phenylphenyl)octanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.052g/cm3 |
|---|---|
| Boiling Point | 473.666ºC at 760 mmHg |
| Molecular Formula | C22H26O3 |
| Molecular Weight | 338.44000 |
| Flash Point | 205.268ºC |
| Exact Mass | 338.18800 |
| PSA | 43.37000 |
| LogP | 5.44000 |
| Index of Refraction | 1.532 |
| InChIKey | AOPVUBIDRJQHMV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCCCCCC(=O)c1ccc(-c2ccccc2)cc1 |
| HS Code | 2918300090 |
|---|
|
~%
ETHYL 8-(4-BIPH... CAS#:362669-47-4 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 14, # 1 p. 283 - 287 |
|
~40%
ETHYL 8-(4-BIPH... CAS#:362669-47-4 |
| Literature: Delorme, Daniel; Woo, Soon Hyung; Vaisburg, Arkadii Patent: US2002/115826 A1, 2002 ; |
|
~%
ETHYL 8-(4-BIPH... CAS#:362669-47-4 |
| Literature: Journal of Medicinal Chemistry, , vol. 45, # 13 p. 2877 - 2885 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| ethyl 8-(4-biphenyl)-8-oxooctanoate |
| Ethyl 7-(4-biphenyl)carbonylheptanoate |