4-Biphenylcarbonyl chloride structure
|
Common Name | 4-Biphenylcarbonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 14002-51-8 | Molecular Weight | 216.663 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 337.1±21.0 °C at 760 mmHg | |
| Molecular Formula | C13H9ClO | Melting Point | 110-112 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 158.4±15.2 °C | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 4-Biphenylcarbonyl Chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 337.1±21.0 °C at 760 mmHg |
| Melting Point | 110-112 °C(lit.) |
| Molecular Formula | C13H9ClO |
| Molecular Weight | 216.663 |
| Flash Point | 158.4±15.2 °C |
| Exact Mass | 216.034195 |
| PSA | 17.07000 |
| LogP | 3.86 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.590 |
| InChIKey | JPVUWCPKMYXOKW-UHFFFAOYSA-N |
| SMILES | O=C(Cl)c1ccc(-c2ccccc2)cc1 |
| Storage condition | 2-8°C |
| Water Solubility | HYDROLYSIS |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Supplemental HS | Reacts violently with water. |
| Precautionary Statements | P280-P303 + P361 + P353-P304 + P340 + P310-P305 + P351 + P338-P305 + P351 + P338 + P310-P310 |
| Hazard Codes | C:Corrosive; |
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39-S43-S45-S25 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 2916399090 |
|
~99%
4-Biphenylcarbo... CAS#:14002-51-8 |
| Literature: ABIOGEN PHARMA S.P.A. Patent: WO2007/88571 A2, 2007 ; Location in patent: Page/Page column 53 ; |
|
~%
4-Biphenylcarbo... CAS#:14002-51-8 |
| Literature: EP885869 A1, ; |
|
~%
4-Biphenylcarbo... CAS#:14002-51-8 |
| Literature: Molecular Crystals and Liquid Crystals Science and Technology Section A: Molecular Crystals and Liquid Crystals, , vol. 364, p. 769 - 777 |
|
~%
4-Biphenylcarbo... CAS#:14002-51-8 |
| Literature: Dalton Transactions, , vol. 40, # 27 p. 7153 - 7164 |
|
~%
4-Biphenylcarbo... CAS#:14002-51-8 |
| Literature: WO2013/28445 A1, ; |
|
~%
4-Biphenylcarbo... CAS#:14002-51-8 |
| Literature: Journal of the American Chemical Society, , vol. 136, # 9 p. 3354 - 3357 |
|
~%
4-Biphenylcarbo... CAS#:14002-51-8 |
| Literature: Molecular Crystals and Liquid Crystals Science and Technology Section A: Molecular Crystals and Liquid Crystals, , vol. 364, p. 769 - 777 |
|
~%
4-Biphenylcarbo... CAS#:14002-51-8 |
| Literature: Journal of the Chemical Society, , p. 3248 |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Application of the Dakin-West reaction for the synthesis of oxazole-containing dual PPARalpha/gamma agonists.
J. Org. Chem. 68(7) , 2623-32, (2003) An improved method for the preparation of a series of oxazole-containing dual PPARalpha/gamma agonists is described. A synthetic sequence utilizing a Dakin-West reaction was devised that allows for th... |
|
|
Theoretical and experimental studies on N-(6-methylpyridin-2-yl-carbamothioyl) biphenyl-4-carboxamide. Yesilkaynak T, et al.
Eur. J. Chem. 1(1) , 1-5, (2010)
|
| (1,1'-Biphenyl)-4-carbonyl chloride |
| Biphenyl-4-carbonyl chloride |
| EINECS 237-804-8 |
| 4-Phenylbenzoyl Chloride |
| MFCD00000692 |
| [1,1'-Biphenyl]-4-carbonyl chloride |
| 4-Biphenylcarbonyl chloride |
| 4-Biphenyl carbonyl chloride |