N-(4-nitrophenyl)-N-phenyl-nitrous amide structure
|
Common Name | N-(4-nitrophenyl)-N-phenyl-nitrous amide | ||
|---|---|---|---|---|
| CAS Number | 3665-70-1 | Molecular Weight | 243.21800 | |
| Density | 1.3g/cm3 | Boiling Point | 453.1ºC at 760 mmHg | |
| Molecular Formula | C12H9N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.8ºC | |
| Name | N-(4-nitrophenyl)-N-phenylnitrous amide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 453.1ºC at 760 mmHg |
| Molecular Formula | C12H9N3O3 |
| Molecular Weight | 243.21800 |
| Flash Point | 227.8ºC |
| Exact Mass | 243.06400 |
| PSA | 78.49000 |
| LogP | 3.93750 |
| Index of Refraction | 1.627 |
| InChIKey | HDKIMHWOSSQGFS-UHFFFAOYSA-N |
| SMILES | O=NN(c1ccccc1)c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2928000090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 6 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| N-Nitroso-N-phenyl-4-nitro-anilin |
| 4-nitro-N-nitroso-N-phenylaniline |
| N-Nitroso-4-nitro-diphenylamin |
| Benzenamine,4-nitro-N-nitroso-N-phenyl |
| 4-Nitro-diphenylnitrosamin |
| p-nitrodiphenylnitrosamine |
| Diphenylamine,4-nitro-N-nitroso |
| N-Nitroso-4-nitrodiphenylamine |