2-(3-(Trifluoromethyl)phenoxy)nicotinic acid structure
|
Common Name | 2-(3-(Trifluoromethyl)phenoxy)nicotinic acid | ||
|---|---|---|---|---|
| CAS Number | 36701-89-0 | Molecular Weight | 283.20300 | |
| Density | 1.421g/cm3 | Boiling Point | 366ºC at 760mmHg | |
| Molecular Formula | C13H8F3NO3 | Melting Point | 156-159ºC | |
| MSDS | USA | Flash Point | 175.2ºC | |
| Name | 2-[3-(Trifluoromethyl)phenoxy]nicotinic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.421g/cm3 |
|---|---|
| Boiling Point | 366ºC at 760mmHg |
| Melting Point | 156-159ºC |
| Molecular Formula | C13H8F3NO3 |
| Molecular Weight | 283.20300 |
| Flash Point | 175.2ºC |
| Exact Mass | 283.04600 |
| PSA | 59.42000 |
| LogP | 3.59090 |
| Index of Refraction | 1.541 |
| InChIKey | OBRGOFGSXWAVNZ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccnc1Oc1cccc(C(F)(F)F)c1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933399090 |
|
~28%
2-(3-(Trifluoro... CAS#:36701-89-0 |
| Literature: Bissantz, Caterina; Dehmlow, Henrietta; Martin, Rainer E.; Obst Sander, Ulrike; Richter, Hans; Ullmer, Christoph Patent: US2010/105906 A1, 2010 ; Location in patent: Page/Page column 22 ; US 20100105906 A1 |
|
~88%
2-(3-(Trifluoro... CAS#:36701-89-0 |
| Literature: Stauffer Chemical Company Patent: US4251263 A1, 1981 ; |
|
~%
2-(3-(Trifluoro... CAS#:36701-89-0 |
| Literature: Molecular Pharmacology, , vol. 69, # 1 p. 165 - 173 |
|
~21%
2-(3-(Trifluoro... CAS#:36701-89-0 |
| Literature: Rouchaud, Jean; Gustin, Fabrice; Moulart, Claude; Herin, Marc Bulletin des Societes Chimiques Belges, 1990 , vol. 99, # 5 p. 339 - 344 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(3-(trifluoromethyl)phenoxy)-3-pyridinecarboxylicacid |
| 2-(3-trifluoromethyl-phenoxy)-nicotinic acid |
| 2-(3-(trifluoromethyl)phenoxy)-3-pyridinecarboxylicaci |