Tempone-d16 structure
|
Common Name | Tempone-d16 | ||
|---|---|---|---|---|
| CAS Number | 36763-53-8 | Molecular Weight | 186.32700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9D16NO2 | Melting Point | 35ºC(lit.) | |
| MSDS | USA | Flash Point | N/A | |
| Symbol |
GHS09 |
Signal Word | Warning | |
Use of Tempone-d16Tempone-d16 is the deuterium labeled Tempone[1]. |
| Name | 3,3,5,5-tetradeuterio-1-λ1-oxidanyl-2,2,6,6-tetrakis(trideuteriomethyl)piperidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | Tempone-d16 is the deuterium labeled Tempone[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Melting Point | 35ºC(lit.) |
|---|---|
| Molecular Formula | C9D16NO2 |
| Molecular Weight | 186.32700 |
| Exact Mass | 186.21900 |
| PSA | 20.31000 |
| LogP | 1.49190 |
| InChIKey | WSGDRFHJFJRSFY-NMRSHPDNSA-N |
| SMILES | CC1(C)CC(=O)CC(C)(C)N1[O] |
|
~84%
Tempone-d16 CAS#:36763-53-8 |
| Literature: Yamada, Ken-Ichi; Kinoshita, Yuichi; Yamasaki, Toshihide; Sadasue, Hiromi; Mito, Fumiya; Nagai, Mika; Matsumoto, Shingo; Aso, Mariko; Suemune, Hiroshi; Sakai, Kiyoshi; Utsumi, Hideo Archiv der Pharmazie, 2008 , vol. 341, # 9 p. 548 - 553 |
|
~%
Tempone-d16 CAS#:36763-53-8 |
| Literature: Drift, E. van der; Rousseeuw, B. A. C.; Smidt, J. Journal of Physical Chemistry, 1984 , vol. 88, # 11 p. 2275 - 2284 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-Oxo-2,2,6,6-tetramethylpiperidine-d16,1-15N-1-oxyl |
| 2,2,6,6-tetramethyl-4-piperidone-N-oxyl-d16 |
| Perdeutero-2,2,6,6-tetramethyl-4-piperidon-N-oxid |
| 4-Oxo-TEMPO-d16,1-15N,free radical |
| 4-Oxo-TEMPO-d16,free radical |
| Perdeutero-1-oxyl-2,2,6,6-tetramethyl-4-piperidone |
| TEMPONE-d16,1-15N |
| 4-oxo-2,2,6,6-tetramethylpiperidine-d16-1-oxyl |
| TEMPONE-d16 |
| 4-Oxo-,2,2,6,6-tetramethylpiperidine-d16-1-oxyl,TEMPONE-d16 |
| MFCD01075420 |