4-(3-nitroanilino)-4-oxobut-2-enoic acid structure
|
Common Name | 4-(3-nitroanilino)-4-oxobut-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 36847-90-2 | Molecular Weight | 236.18100 | |
| Density | 1.517g/cm3 | Boiling Point | 508.9ºC at 760mmHg | |
| Molecular Formula | C10H8N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 261.6ºC | |
| Name | 4-(3-nitroanilino)-4-oxobut-2-enoic acid |
|---|
| Density | 1.517g/cm3 |
|---|---|
| Boiling Point | 508.9ºC at 760mmHg |
| Molecular Formula | C10H8N2O5 |
| Molecular Weight | 236.18100 |
| Flash Point | 261.6ºC |
| Exact Mass | 236.04300 |
| PSA | 112.22000 |
| LogP | 1.77030 |
| Index of Refraction | 1.667 |
| InChIKey | MZRKEXUFISGDKS-UHFFFAOYSA-N |
| SMILES | O=C(O)C=CC(=O)Nc1cccc([N+](=O)[O-])c1 |
| HS Code | 2922509090 |
|---|
|
~%
4-(3-nitroanili... CAS#:36847-90-2 |
| Literature: Kretow; Kultschizkaja Zhurnal Obshchei Khimii, 1955 , vol. 25, p. 2474,2479;engl.Ausg.S.2363,2366 |
|
~%
4-(3-nitroanili... CAS#:36847-90-2 |
| Literature: Caronna Gazzetta Chimica Italiana, 1948 , vol. 78, p. 38,41 |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |