4-(3-methoxyanilino)-4-oxobut-2-enoic acid structure
|
Common Name | 4-(3-methoxyanilino)-4-oxobut-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 31460-27-2 | Molecular Weight | 221.20900 | |
| Density | 1.318g/cm3 | Boiling Point | 467.8ºC at 760 mmHg | |
| Molecular Formula | C11H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.7ºC | |
| Name | 4-(3-methoxyanilino)-4-oxobut-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.318g/cm3 |
|---|---|
| Boiling Point | 467.8ºC at 760 mmHg |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.20900 |
| Flash Point | 236.7ºC |
| Exact Mass | 221.06900 |
| PSA | 75.63000 |
| LogP | 1.34750 |
| Index of Refraction | 1.609 |
| InChIKey | CXOUTHKBZTXXAU-WAYWQWQTSA-N |
| SMILES | COc1cccc(NC(=O)C=CC(=O)O)c1 |
|
~94%
4-(3-methoxyani... CAS#:31460-27-2 |
| Literature: Gupta; Wagh Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2006 , vol. 45, # 3 p. 697 - 702 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Maleinsaeure-mono-3-methoxy-anilid |
| N-(3-Methoxyphenyl)maleamidic acid |
| (Z)-4-(3-Methoxyphenylamino)-4-oxo-2-butenoic acid |
| N-(3-METHOXYPHENYL)MALEAMIC ACID |
| N-(M-METHOXYPHENYL)MALEAMIC ACID |
| Maleic acid mono(3-methoxyphenyl)amide |