3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)propan-1-ol structure
|
Common Name | 3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)propan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 36880-07-6 | Molecular Weight | 538.26400 | |
| Density | 1.548g/cm3 | Boiling Point | 285.4ºC at 760mmHg | |
| Molecular Formula | C13H11F17OS | Melting Point | 70-71ºC | |
| MSDS | N/A | Flash Point | 126.4ºC | |
| Name | 3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)propan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.548g/cm3 |
|---|---|
| Boiling Point | 285.4ºC at 760mmHg |
| Melting Point | 70-71ºC |
| Molecular Formula | C13H11F17OS |
| Molecular Weight | 538.26400 |
| Flash Point | 126.4ºC |
| Exact Mass | 538.02600 |
| PSA | 45.53000 |
| LogP | 6.50150 |
| Index of Refraction | 1.347 |
| InChIKey | MQUNHCVXSGLKTJ-UHFFFAOYSA-N |
| SMILES | OCCCSCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2930909090 |
|
~93%
3-(3,3,4,4,5,5,... CAS#:36880-07-6 |
| Literature: Pees; Cahuzac; Sindt; Ameduri; Paul; Boutevin; Mieloszynski Journal of Fluorine Chemistry, 2001 , vol. 108, # 2 p. 133 - 142 |
|
~%
3-(3,3,4,4,5,5,... CAS#:36880-07-6 |
| Literature: Pees; Cahuzac; Sindt; Ameduri; Paul; Boutevin; Mieloszynski Journal of Fluorine Chemistry, 2001 , vol. 108, # 2 p. 133 - 142 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| PC2469 |
| 2-perfluorooctyl-ethyl 3-hydroxy-propyl sulfide |