1h,1h,2h,2h-perfluorodecanethiol structure
|
Common Name | 1h,1h,2h,2h-perfluorodecanethiol | ||
|---|---|---|---|---|
| CAS Number | 34143-74-3 | Molecular Weight | 480.18500 | |
| Density | 1.678 g/mL at 25 °C | Boiling Point | 82 °C | |
| Molecular Formula | C10H5F17S | Melting Point | 15 °C | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecane-1-thiol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.678 g/mL at 25 °C |
|---|---|
| Boiling Point | 82 °C |
| Melting Point | 15 °C |
| Molecular Formula | C10H5F17S |
| Molecular Weight | 480.18500 |
| Flash Point | >230 °F |
| Exact Mass | 479.98400 |
| PSA | 38.80000 |
| LogP | 6.31570 |
| Index of Refraction | n20/D 1.333 |
| InChIKey | URJIJZCEKHSLHA-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCS |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2930909090 |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Comprehensive bioimaging with fluorinated nanoparticles using breathable liquids.
Nat. Commun. 6 , 5998, (2015) Fluorocarbons are lipophobic and non-polar molecules that exhibit remarkable biocompatibility, with applications in liquid ventilation and synthetic blood. The unique properties of these compounds hav... |
| 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Heptadecafluoro-1-decanethiol |
| 1H,1H,2H,2H-Perfluorodecanethiol |
| MFCD00792429 |
| 1H,1H,2H,2H-Perfluoro-1-decanethiol |
| 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro-decane-1-thiol |
| 1H,1H,2H,2H-perfluorodecane-1-thiol |