1-(4,4-diphenylbutyl)-4-methylpiperazine,dihydrochloride structure
|
Common Name | 1-(4,4-diphenylbutyl)-4-methylpiperazine,dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 37028-02-7 | Molecular Weight | 381.38200 | |
| Density | N/A | Boiling Point | 437.1ºC at 760 mmHg | |
| Molecular Formula | C21H30Cl2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.8ºC | |
| Name | 1-(4,4-diphenylbutyl)-4-methylpiperazine,dihydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 437.1ºC at 760 mmHg |
|---|---|
| Molecular Formula | C21H30Cl2N2 |
| Molecular Weight | 381.38200 |
| Flash Point | 195.8ºC |
| Exact Mass | 380.17900 |
| PSA | 6.48000 |
| LogP | 5.32590 |
| InChIKey | WRDYTHMDNNMYTK-UHFFFAOYSA-N |
| SMILES | CN1CCN(CCCC(c2ccccc2)c2ccccc2)CC1.Cl.Cl |
|
~%
1-(4,4-diphenyl... CAS#:37028-02-7 |
| Literature: Miyano; Tatsuoka; Suzuki; Imao; Satoh; Ishihara; Hirotsu; Kihara; Hatta; Horikawa; Sumoto Chemical and Pharmaceutical Bulletin, 1990 , vol. 38, # 6 p. 1570 - 1574 |
|
~%
1-(4,4-diphenyl... CAS#:37028-02-7 |
| Literature: Miyano; Tatsuoka; Suzuki; Imao; Satoh; Ishihara; Hirotsu; Kihara; Hatta; Horikawa; Sumoto Chemical and Pharmaceutical Bulletin, 1990 , vol. 38, # 6 p. 1570 - 1574 |
|
~%
1-(4,4-diphenyl... CAS#:37028-02-7 |
| Literature: Miyano; Tatsuoka; Suzuki; Imao; Satoh; Ishihara; Hirotsu; Kihara; Hatta; Horikawa; Sumoto Chemical and Pharmaceutical Bulletin, 1990 , vol. 38, # 6 p. 1570 - 1574 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-(4,4-Diphenylbutyl)-4-methylpiperazine dihydrochloride |
| Piperazine,1-(4,4-diphenylbutyl)-4-methyl-,dihydrochloride |