Ethyl 4-chloro-8-methylquinoline-3-carboxylate structure
|
Common Name | Ethyl 4-chloro-8-methylquinoline-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 37041-32-0 | Molecular Weight | 249.69300 | |
| Density | 1.252g/cm3 | Boiling Point | 346.4ºC at 760 mmHg | |
| Molecular Formula | C13H12ClNO2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 163.3ºC | |
| Name | ethyl 1-chloro-5-methyl-2H-quinoxaline-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.252g/cm3 |
|---|---|
| Boiling Point | 346.4ºC at 760 mmHg |
| Molecular Formula | C13H12ClNO2 |
| Molecular Weight | 249.69300 |
| Flash Point | 163.3ºC |
| Exact Mass | 249.05600 |
| PSA | 39.19000 |
| LogP | 3.37330 |
| Index of Refraction | 1.601 |
| InChIKey | PGGVUZUNDXCMSS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cnc2c(C)cccc2c1Cl |
| RIDADR | NONH for all modes of transport |
|---|---|
| HS Code | 2933499090 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| ETHYL 4-CHLORO-8-METHYLQUINOXALINE-3-CARBOXYLATE |
| 4-chloro-8-methyl-quinoline-3-carboxylic acid ethyl ester |
| MFCD00173399 |