2-(o-tolylaminomethylene)malonic acid diethyl ester structure
|
Common Name | 2-(o-tolylaminomethylene)malonic acid diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 19146-73-7 | Molecular Weight | 277.31600 | |
| Density | 1.15g/cm3 | Boiling Point | 346ºC at 760 mmHg | |
| Molecular Formula | C15H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163ºC | |
| Name | 2-(o-tolylaminomethylene)malonic acid diethyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 346ºC at 760 mmHg |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.31600 |
| Flash Point | 163ºC |
| Exact Mass | 277.13100 |
| PSA | 64.63000 |
| LogP | 2.49000 |
| Vapour Pressure | 5.95E-05mmHg at 25°C |
| Index of Refraction | 1.547 |
| InChIKey | ZRZMZJLFPGQKKY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=CNc1ccccc1C)C(=O)OCC |
|
~98%
2-(o-tolylamino... CAS#:19146-73-7 |
| Literature: Dave, Chaitanya G.; Joshipura, Hardik M. Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2002 , vol. 41, # 3 p. 650 - 652 |
|
~%
2-(o-tolylamino... CAS#:19146-73-7 |
| Literature: Duffin; Kendall Journal of the Chemical Society, 1948 , p. 893 |
| o-Toluidinomethylen-malonsaeure-diaethylester |
| o-toluidinomethylene-malonic acid diethyl ester |