Potassium Hydroquinone Monosulfate structure
|
Common Name | Potassium Hydroquinone Monosulfate | ||
|---|---|---|---|---|
| CAS Number | 37067-27-9 | Molecular Weight | 228.26400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H5KO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dipotassium,benzene-1,4-diol,sulfate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H5KO5S |
|---|---|
| Molecular Weight | 228.26400 |
| Exact Mass | 227.94900 |
| PSA | 95.04000 |
| LogP | 1.31200 |
| InChIKey | KYQHUXZXYUBUPX-UHFFFAOYSA-M |
| SMILES | O=S(=O)([O-])Oc1ccc(O)cc1.[K+] |
|
~7%
Potassium Hydro... CAS#:37067-27-9 |
| Literature: Quintus, Joachim; Kovar, Karl-Artur; Link, Peter; Hamacher, Harald Planta Medica, 2005 , vol. 71, # 2 p. 147 - 152 |
| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Hydroquinone Monosulfate Potassium Salt |
| Hydrochinon-monosulfat |
| potassium p-hydroxyphenyl sulfate |
| hydroquinone sulphate potassium salt |
| EINECS 253-332-5 |
| PotassiuM Hydroquinone Monosulfate |
| potassium 4-hydroxyphenylsulfate |