benzo[g]quinoline-5,10-dione structure
|
Common Name | benzo[g]quinoline-5,10-dione | ||
|---|---|---|---|---|
| CAS Number | 3712-09-2 | Molecular Weight | 209.20000 | |
| Density | 1.373g/cm3 | Boiling Point | 407ºC at 760 mmHg | |
| Molecular Formula | C13H7NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.1ºC | |
| Name | benzo[g]quinoline-5,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.373g/cm3 |
|---|---|
| Boiling Point | 407ºC at 760 mmHg |
| Molecular Formula | C13H7NO2 |
| Molecular Weight | 209.20000 |
| Flash Point | 202.1ºC |
| Exact Mass | 209.04800 |
| PSA | 47.03000 |
| LogP | 1.85700 |
| Index of Refraction | 1.668 |
| InChIKey | XPHIPZFRUPJGRX-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)c2ncccc21 |
| HS Code | 2933990090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-azaanthracene-9,10-dione |
| 1-azaanthraquinone |
| Benzo[g]chinolin-5,10-dion |
| 5,10-Dioxo-5,10-dihydro-benzo<g>chinolin |