ETHYL3-PHENYL-1H-INDOLE-2-CARBOXYLATE structure
|
Common Name | ETHYL3-PHENYL-1H-INDOLE-2-CARBOXYLATE | ||
|---|---|---|---|---|
| CAS Number | 37129-23-0 | Molecular Weight | 265.30700 | |
| Density | 1.197g/cm3 | Boiling Point | 476.9ºC at 760mmHg | |
| Molecular Formula | C17H15NO2 | Melting Point | 134-136ºC | |
| MSDS | N/A | Flash Point | 242.2ºC | |
| Name | ethyl 3-phenyl-1h-indole-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.197g/cm3 |
|---|---|
| Boiling Point | 476.9ºC at 760mmHg |
| Melting Point | 134-136ºC |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.30700 |
| Flash Point | 242.2ºC |
| Exact Mass | 265.11000 |
| PSA | 42.09000 |
| LogP | 4.01160 |
| Index of Refraction | 1.637 |
| InChIKey | JPDIBWCNNQFQEP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1[nH]c2ccccc2c1-c1ccccc1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| Precursor 8 | |
|---|---|
| DownStream 5 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: Luciferase/luciferin-expressing antifolate-resistant parasites were used to infect a ...
Source: ChEMBL
Target: HepG2-CD81
External Id: CHEMBL4483864
|
|
Name: Luciferase/luciferin-expressing antifolate-resistant parasites were used to infect a ...
Source: ChEMBL
Target: Plasmodium berghei
External Id: CHEMBL4483863
|
| ethylphenylindolecarboxylate |
| 3-Phenyl-1H-indole-2-carboxylic acid ethyl ester |
| ethyl 3-phenyl-2-indolecarboxylate |
| Ethyl3-Phenyl-1h-Indole-2-Carboxylate |
| ethyl 3-phenylindole-2-carboxylate |
| 3-Phenyl-indol-2-carbonsaeure-aethylester |
| 3-phenyl-indole-2-carboxylic acid ethyl ester |