N, N-Dimethyldiphenylphosphinamide structure
|
Common Name | N, N-Dimethyldiphenylphosphinamide | ||
|---|---|---|---|---|
| CAS Number | 3732-84-1 | Molecular Weight | 245.25700 | |
| Density | 1.13g/cm3 | Boiling Point | 354.2ºC at 760 mmHg | |
| Molecular Formula | C14H16NOP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168ºC | |
| Name | N-diphenylphosphoryl-N-methylmethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 354.2ºC at 760 mmHg |
| Molecular Formula | C14H16NOP |
| Molecular Weight | 245.25700 |
| Flash Point | 168ºC |
| Exact Mass | 245.09700 |
| PSA | 30.12000 |
| LogP | 2.47710 |
| Index of Refraction | 1.575 |
| InChIKey | KGHXVBWKESEXNO-UHFFFAOYSA-N |
| SMILES | CN(C)P(=O)(c1ccccc1)c1ccccc1 |
| HS Code | 2924299090 |
|---|
|
~80%
N, N-Dimethyldi... CAS#:3732-84-1 |
| Literature: Bondarenko; Kharlamov; Vendilo Russian Chemical Bulletin, 2009 , vol. 58, # 9 p. 1872 - 1885 |
|
~%
N, N-Dimethyldi... CAS#:3732-84-1 |
| Literature: Bondarenko; Kharlamov; Vendilo Russian Chemical Bulletin, 2009 , vol. 58, # 9 p. 1872 - 1885 |
|
~%
N, N-Dimethyldi... CAS#:3732-84-1 |
| Literature: Shmurowa et al. Zhurnal Obshchei Khimii, 1959 , vol. 29, p. 2083,2087; engl. Ausg. S. 2052, 2055 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N,N-Dimethyldiphenylphosphinsaeureamid |
| Diphenyl-phosphinsaeure-dimethylamid |
| Diphenylphosphonigsaeure-dimethylamid |
| Dimethylamino-diphenyl-phosphinoxid |
| N,N-Dimethyl-P,P-diphenylphosphinic amide |
| diphenylphosphinic acid dimethylamide |
| Diphenylphosphinsaeure-N,N-dimethylamid |
| N,P-diphenylphosphinic amide |
| N,N-Dimethyldiphenylphosphinamide |