Calconcarboxylic acid structure
|
Common Name | Calconcarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 3737-95-9 | Molecular Weight | 438.410 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C21H14N2O7S | Melting Point | 300 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
Use of Calconcarboxylic acidCalconcarboxylic acid, an azo dye, is a silver-ion sensitizer. Calconcarboxylic acid can be used for detection of proteins on polyacrylamide gels[1][2]. |
| Name | Calconcarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Calconcarboxylic acid, an azo dye, is a silver-ion sensitizer. Calconcarboxylic acid can be used for detection of proteins on polyacrylamide gels[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Melting Point | 300 °C(lit.) |
| Molecular Formula | C21H14N2O7S |
| Molecular Weight | 438.410 |
| Exact Mass | 438.052185 |
| PSA | 165.23000 |
| LogP | 2.86 |
| Index of Refraction | 1.734 |
| InChIKey | MVQBFZXBLLMXGS-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc2ccccc2c(N=Nc2c(O)cc(S(=O)(=O)O)c3ccccc23)c1O |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility | slightly soluble |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2842909090 |
| HS Code | 2927000090 |
|---|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
High-performance liquid chromatography determination of nitrated polycyclic aromatic hydrocarbons by indirect fluorescence detection.
Biomed. Chromatogr. 23(2) , 166-9, (2009) A high-performance liquid chromatography (HPLC) method for the analysis of nitrated polcyclic aromatic hydrocarbons (NPAHs) is reported. NPAH mixtures were pre-concentrated using solid-phase extractio... |
|
|
Determination of microgram amounts of calcium in small biological samples by EDTA titration using Patton and Reeder's indicator.
Analyst 106 , 227, (1981)
|
|
|
Electrophoretic nanotechnology of composite electrodes for electrochemical supercapacitors.
J. Phys. Chem. B 117(6) , 1563-70, (2013) The electrophoretic deposition (EPD) method has been developed for the fabrication of MnO(2)-multiwalled carbon nanotube (MWCNT) films for application in electrochemical supercapacitors (ESs). For MWC... |
| 2,2'-dihydroxy-4'-sulfo-1,1'-azonaphthalene-3-carboxylic acid |
| 3-hydroxy-4(2-hydroxy-4-sulfo-1-naphthyl-azo)-2-naphthalenecarboxylic acid |
| 2-Naphthalenecarboxylic acid, 3-hydroxy-4-((2-hydroxy-4-sulfo-1-naphthalenyl)azo)- |
| 2-Hydroxy-1-(2-hydroxy-4-sulfo-1-naphthylazo)-3-naphthoic Acid |
| 2-Naphthoic acid, 3-hydroxy-4-[(2-hydroxy-4-sulfo-1-naphthyl)azo]- |
| 3-Hydroxy-4-[(E)-(2-hydroxy-4-sulfo-1-naphthyl)diazenyl]-2-naphthoic acid |
| EINECS 223-117-0 |
| 3-hydroxy-4-[(E)-(2-hydroxy-4-sulfonaphthalen-1-yl)diazenyl]naphthalene-2-carboxylic acid |
| HHSNN |
| 3-Hydroxy-4-(2-hydroxy-4-sulfo-1-naphthylazo)naphthalene-2-carboxylic acid,indicator grade |
| Calcon-carboxylic Acid |
| CAL-RED(R) |
| Patton and Reeder’s |
| MFCD00004078 |
| Patton and Reeder Dye |
| HHSNNA |
| CAL RED |
| Calconcarboxylic aci |
| 2-Naphthalenecarboxylic acid, 3-hydroxy-4-[(E)-2-(2-hydroxy-4-sulfo-1-naphthalenyl)diazenyl]- |
| 3-hydroxy-4-[(2-hydroxy-4-sulfo-1-naphthyl)azo]naphthalene-2-carboxylic acid |
| CalconCarboxylicAcidGr |
| 3-Hydroxy-4-(2-hydroxy-4-sulfo-1-naphthylazo)naphthalene-2-carboxylic acid |
| Kalces |