5-methyl-4-(2-thiazolylazo)resorcinol structure
|
Common Name | 5-methyl-4-(2-thiazolylazo)resorcinol | ||
|---|---|---|---|---|
| CAS Number | 37422-56-3 | Molecular Weight | 235.26200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9N3O2S | Melting Point | 211-213ºC (dec.)(lit.) | |
| MSDS | USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 5-methyl-4-(2-thiazolylazo)resorcinol |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 211-213ºC (dec.)(lit.) |
|---|---|
| Molecular Formula | C10H9N3O2S |
| Molecular Weight | 235.26200 |
| Exact Mass | 235.04200 |
| PSA | 106.31000 |
| LogP | 3.27810 |
| Index of Refraction | 1.709 |
| InChIKey | LABKTXRFMJIJAU-UHFFFAOYSA-N |
| SMILES | Cc1cc(O)cc(O)c1N=Nc1nccs1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2934100090 |
|
~%
5-methyl-4-(2-t... CAS#:37422-56-3 |
| Literature: Jensen,B.S. Acta Chemica Scandinavica (1947-1973), 1960 , vol. 14, p. 927 - 932 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| TAO~4-(2-Thiazolylazo)orcinol |
| 5-methyl-4-thiazol-2-ylazo-benzene-1,3-diol |
| MFCD00011562 |
| 6-(2-THIAZOLYLAZO)ORCINOL |
| 5-methyl-4-(2-thiazolylazo)-1,3-benzenediol |
| 6-(2'-Thiazolylazo)orcin |
| 5-Methyl-4-(2-thiazolylazo)-1,3-benzenediol,TAO |