Nonafluoro-1-butanesulfonic Acid structure
|
Common Name | Nonafluoro-1-butanesulfonic Acid | ||
|---|---|---|---|---|
| CAS Number | 375-73-5 | Molecular Weight | 300.100 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 112-114 °C14 mm Hg(lit.) | |
| Molecular Formula | C4HF9O3S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | Nonafluoro-1-butanesulfonic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 112-114 °C14 mm Hg(lit.) |
| Molecular Formula | C4HF9O3S |
| Molecular Weight | 300.100 |
| Flash Point | >230 °F |
| Exact Mass | 299.950256 |
| PSA | 62.75000 |
| LogP | 3.68 |
| Index of Refraction | 1.318 |
| InChIKey | JGTNAGYHADQMCM-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Storage condition | 2-8°C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H314 |
| Supplemental HS | Reacts violently with water. |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Phrases | 14-22-34 |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| RTECS | EK5930000 |
| HS Code | 2904909090 |
| Precursor 6 | |
|---|---|
| DownStream 7 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Spatiotemporal distribution and mass loadings of perfluoroalkyl substances in the Yangtze River of China.
Sci. Total Environ. 493 , 580-7, (2014) A systematic investigation into contamination profiles of eighteen perfluoroalkyl substances (PFASs) in both surface water and sediments of Yangtze River was carried out by using high performance liqu... |
| EINECS 206-793-1 |
| Nonafluorobutane-1-sulfonic acid |
| Perfluorobutane-1-sulphonic acid |
| 1-Perfluorobutanesulfonic acid |
| 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid |
| Perfluorobutanesulfonic acid |
| 1,1,2,2,3,3,4,4,4-Nonafluoro-1-butanesulfonic acid |
| perfluoro-1-butanesulfonic acid |
| Nonafluorobutanesulfonic acid |
| NONAFLUORO-1-BUTANESULFONIC ACID |
| MFCD01320794 |
| Nonafluorobutanesulphonic acid |