1-[2-oxopropyl(phenyl)phosphoryl]propan-2-one structure
|
Common Name | 1-[2-oxopropyl(phenyl)phosphoryl]propan-2-one | ||
|---|---|---|---|---|
| CAS Number | 37506-13-1 | Molecular Weight | 238.21900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15O3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[2-oxopropyl(phenyl)phosphoryl]propan-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H15O3P |
|---|---|
| Molecular Weight | 238.21900 |
| Exact Mass | 238.07600 |
| PSA | 61.02000 |
| LogP | 1.85300 |
| InChIKey | CXWZJWQGWUJAFR-UHFFFAOYSA-N |
| SMILES | CC(=O)CP(=O)(CC(C)=O)c1ccccc1 |
|
~%
1-[2-oxopropyl(... CAS#:37506-13-1 |
| Literature: Quin, Louis D.; Kisalus, John C. Phosphorus and Sulfur and the Related Elements, 1985 , vol. 22, p. 35 - 40 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| bis(2-oxopropyl)(phenyl)phosphane oxide |
| 2-Propanone,1,1'-(phenylphosphinylidene)bis |
| bis(2-oxopropyl)phenylphosphine oxide |