6-bromo-2-methylquinoline-4-carboxylic acid structure
|
Common Name | 6-bromo-2-methylquinoline-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 37509-21-0 | Molecular Weight | 266.09100 | |
| Density | 1.644g/cm3 | Boiling Point | 397.3ºC at 760 mmHg | |
| Molecular Formula | C11H8BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.1ºC | |
| Name | 6-bromo-2-methylquinoline-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.644g/cm3 |
|---|---|
| Boiling Point | 397.3ºC at 760 mmHg |
| Molecular Formula | C11H8BrNO2 |
| Molecular Weight | 266.09100 |
| Flash Point | 194.1ºC |
| Exact Mass | 264.97400 |
| PSA | 50.19000 |
| LogP | 3.00390 |
| Index of Refraction | 1.687 |
| InChIKey | QOTNALKWUMJLPS-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(=O)O)c2cc(Br)ccc2n1 |
| Storage condition | 2-8°C |
| HS Code | 2933499090 |
|---|
|
~93%
6-bromo-2-methy... CAS#:37509-21-0 |
| Literature: Zemtsova; Trakhtenberg; Galkina Russian Journal of Organic Chemistry, 2003 , vol. 39, # 12 p. 1803 - 1803 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-Brom-2-methyl-chinolin-4-carbonsaeure |
| 6-bromo-2-methyl-quinoline-4-carboxylic acid |
| 2-Methyl-6-brom-cinchoninsaeure |