ethyl 6-bromo-2-methyl-quinoline-4-carboxylate structure
|
Common Name | ethyl 6-bromo-2-methyl-quinoline-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 62482-30-8 | Molecular Weight | 294.14400 | |
| Density | 1.444g/cm3 | Boiling Point | 378.9ºC at 760 mmHg | |
| Molecular Formula | C13H12BrNO2 | Melting Point | 110ºC | |
| MSDS | USA | Flash Point | 182.9ºC | |
| Name | ethyl 6-bromo-2-methylquinoline-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.444g/cm3 |
|---|---|
| Boiling Point | 378.9ºC at 760 mmHg |
| Melting Point | 110ºC |
| Molecular Formula | C13H12BrNO2 |
| Molecular Weight | 294.14400 |
| Flash Point | 182.9ºC |
| Exact Mass | 293.00500 |
| PSA | 39.19000 |
| LogP | 3.48240 |
| Index of Refraction | 1.615 |
| InChIKey | KOVIYCANWGLBHA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(C)nc2ccc(Br)cc12 |
|
~%
ethyl 6-bromo-2... CAS#:62482-30-8 |
| Literature: Buchman et al. Journal of the American Chemical Society, 1946 , vol. 68, p. 2692,2693 |
|
~%
ethyl 6-bromo-2... CAS#:62482-30-8 |
| Literature: Buchman et al. Journal of the American Chemical Society, 1946 , vol. 68, p. 2692,2693 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 6-bromo-2-methyl-quinoline-4-carboxylic acid ethyl ester |
| 6-Brom-2-methyl-chinolin-4-carbonsaeure-aethylester |
| HMS542A20 |