5'-Chloro-2'-hydroxy-3-biphenylcarboxylic acid structure
|
Common Name | 5'-Chloro-2'-hydroxy-3-biphenylcarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 376592-57-3 | Molecular Weight | 248.662 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 455.3±35.0 °C at 760 mmHg | |
| Molecular Formula | C13H9ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.2±25.9 °C | |
| Name | 3-(5-chloro-2-hydroxyphenyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 455.3±35.0 °C at 760 mmHg |
| Molecular Formula | C13H9ClO3 |
| Molecular Weight | 248.662 |
| Flash Point | 229.2±25.9 °C |
| Exact Mass | 248.024017 |
| PSA | 57.53000 |
| LogP | 3.71 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.647 |
| InChIKey | ODGCLNKGAPCIAE-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc(-c2cc(Cl)ccc2O)c1 |
| HS Code | 2922299090 |
|---|
|
~96%
5'-Chloro-2'-hy... CAS#:376592-57-3 |
| Literature: ASSIA CHEMICAL INDUSTRIES LTD.; TEVA PHARMACEUTICAL USA, INC.; AVDAGIC, Amir; BARAN, Phil, S. Patent: WO2013/49605 A1, 2013 ; Location in patent: Paragraph 0050 ; |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5'-Chloro-2'-hydroxy[1,1'-biphenyl]-3-carboxylic acid |
| [1,1'-Biphenyl]-3-carboxylic acid, 5'-chloro-2'-hydroxy- |
| 5'-chloro-2'-hydroxybiphenyl-3-carboxylic acid |
| 5'-Chloro-2'-hydroxy-3-biphenylcarboxylic acid |