3'-Amino-2'-hydroxy-3-biphenylcarboxylic acid structure
|
Common Name | 3'-Amino-2'-hydroxy-3-biphenylcarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 376592-93-7 | Molecular Weight | 229.231 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 474.8±45.0 °C at 760 mmHg | |
| Molecular Formula | C13H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.0±28.7 °C | |
| Name | 3-(3-amino-2-hydroxyphenyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 474.8±45.0 °C at 760 mmHg |
| Molecular Formula | C13H11NO3 |
| Molecular Weight | 229.231 |
| Flash Point | 241.0±28.7 °C |
| Exact Mass | 229.073898 |
| PSA | 83.55000 |
| LogP | 1.48 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.686 |
| InChIKey | ZXLYSSHNDUXXIN-UHFFFAOYSA-N |
| SMILES | Nc1cccc(-c2cccc(C(=O)O)c2)c1O |
| HS Code | 2922509090 |
|---|
|
~89%
3'-Amino-2'-hyd... CAS#:376592-93-7 |
| Literature: ASSIA CHEMICAL INDUSTRIES LTD.; TEVA PHARMACEUTICAL USA, INC.; AVDAGIC, Amir; BARAN, Phil, S. Patent: WO2013/49605 A1, 2013 ; Location in patent: Paragraph 0058 ; |
|
~52%
3'-Amino-2'-hyd... CAS#:376592-93-7 |
| Literature: PLIVA HRVATSKA D.O.O. Patent: US2010/256212 A1, 2010 ; Location in patent: Page/Page column 16 ; |
|
~%
3'-Amino-2'-hyd... CAS#:376592-93-7 |
| Literature: WO2013/49605 A1, ; |
|
~%
3'-Amino-2'-hyd... CAS#:376592-93-7 |
| Literature: WO2013/49605 A1, ; |
|
~%
3'-Amino-2'-hyd... CAS#:376592-93-7 |
| Literature: WO2013/49605 A1, ; |
|
~%
3'-Amino-2'-hyd... CAS#:376592-93-7 |
| Literature: WO2013/49605 A1, ; |
|
~%
3'-Amino-2'-hyd... CAS#:376592-93-7 |
| Literature: WO2013/49605 A1, ; |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| bip030 |
| 3'-Amino-2'-hydroxy-3-biphenylcarboxylic acid |
| [1,1'-Biphenyl]-3-carboxylic acid, 3'-amino-2'-hydroxy- |
| 3'-amino-2'-hydroxy-biphenyl-3-carboxylic acid |
| 3'-amino-2'-hydroxybiphenyl-3-carboxylic acid |
| Eltrombopag olamine Intermediate 1 |