2,2,3,3,4,4,4-heptafluoro-N-(2-hydroxyethyl)butanamide structure
|
Common Name | 2,2,3,3,4,4,4-heptafluoro-N-(2-hydroxyethyl)butanamide | ||
|---|---|---|---|---|
| CAS Number | 377-66-2 | Molecular Weight | 257.10600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H6F7NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2,3,3,4,4,4-heptafluoro-N-(2-hydroxyethyl)butanamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H6F7NO2 |
|---|---|
| Molecular Weight | 257.10600 |
| Exact Mass | 257.02900 |
| PSA | 52.82000 |
| LogP | 1.76810 |
| InChIKey | KPTAUHCSUNOZRL-UHFFFAOYSA-N |
| SMILES | O=C(NCCO)C(F)(F)C(F)(F)C(F)(F)F |
|
~67%
2,2,3,3,4,4,4-h... CAS#:377-66-2 |
| Literature: Saloutina; Zapevalov; Kodess; Saloutin Russian Journal of Nondestructive Testing, 1997 , vol. 33, # 2 p. 265 - 272 |
|
~%
2,2,3,3,4,4,4-h... CAS#:377-66-2 |
| Literature: Hauptschein; Braun Journal of the American Chemical Society, 1955 , vol. 77, p. 4930 |
|
~%
2,2,3,3,4,4,4-h... CAS#:377-66-2 |
| Literature: Hauptschein; Braun Journal of the American Chemical Society, 1955 , vol. 77, p. 4930 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Butanamide,2,2,3,3,4,4,4-heptafluoro-N-(2-hydroxyethyl) |
| Heptafluor-buttersaeure-(2-hydroxy-aethylamid) |
| heptafluoro-butyric acid-(2-hydroxy-ethylamide) |