1,1,1,2,2,3,3,5,5,6,6,7,7,7-tetradecafluoroheptan-4-one structure
|
Common Name | 1,1,1,2,2,3,3,5,5,6,6,7,7,7-tetradecafluoroheptan-4-one | ||
|---|---|---|---|---|
| CAS Number | 378-90-5 | Molecular Weight | 366.05200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7F14O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1,1,2,2,3,3,5,5,6,6,7,7,7-tetradecafluoroheptan-4-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7F14O |
|---|---|
| Molecular Weight | 366.05200 |
| Exact Mass | 365.97300 |
| PSA | 17.07000 |
| LogP | 4.22130 |
| InChIKey | MZYSRYKCZXWEGM-UHFFFAOYSA-N |
| SMILES | O=C(C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| HS Code | 2914700090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 7 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4-Heptanone,1,1,1,2,2,3,3,5,5,6,6,7,7,7-tetradecafluoro |
| 1,1,1,2,2,3,3,5,5,6,6,7,7,7-tetradecafluoro-heptan-4-one |
| perfluoro-4-heptanone |
| di-(perfluoro n-propyl) ketone |
| C3F7COC3F7 ketone |
| tetradecafluoro-heptan-4-one |
| perfluoroheptan-4-one |