methyl heptafluorobutyrate structure
|
Common Name | methyl heptafluorobutyrate | ||
|---|---|---|---|---|
| CAS Number | 356-24-1 | Molecular Weight | 228.06500 | |
| Density | 1.472 g/mL at 25 °C(lit.) | Boiling Point | 80-81 °C(lit.) | |
| Molecular Formula | C5H3F7O2 | Melting Point | -86°C | |
| MSDS | N/A | Flash Point | >230 °F | |
| Name | methyl 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.472 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 80-81 °C(lit.) |
| Melting Point | -86°C |
| Molecular Formula | C5H3F7O2 |
| Molecular Weight | 228.06500 |
| Flash Point | >230 °F |
| Exact Mass | 228.00200 |
| PSA | 26.30000 |
| LogP | 1.99230 |
| Vapour density | >1 (vs air) |
| Index of Refraction | n20/D 1.293(lit.) |
| InChIKey | MRPUVAKBXDBGJQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| WGK Germany | 3 |
| HS Code | 2915900090 |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| Methyl perfluorobutyrate |
| Methyl heptafluorobutanoate |
| Butanoic acid,heptafluoro-,methyl ester |
| EINECS 206-600-0 |
| Heptafluorobutyric Acid Methyl Ester |
| MFCD00000433 |
| Butyric acid,heptafluoro-,methyl ester |
| methyl heptafluorobutyrate |
| Perfluorobutyric Acid Methyl Ester |
| heptafluoro-butanoic acid,methyl ester |
| Heptafluor-buttersaeure-methylester |