6-Hydroxykynurenic acid structure
|
Common Name | 6-Hydroxykynurenic acid | ||
|---|---|---|---|---|
| CAS Number | 3778-29-8 | Molecular Weight | 205.16700 | |
| Density | 1.569g/cm3 | Boiling Point | 455.6ºC at 760mmHg | |
| Molecular Formula | C10H7NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.4ºC | |
Use of 6-Hydroxykynurenic acid6-Hydroxykynurenic acid (6-HKA) is a derivative of kynurenic acid (KYNA) and can be isolated from Ginkgo leaves. 6-Hydroxykynurenic acid is a low-affinity NMDAR antagonist (IC50: 59 μM)[1]. |
| Name | 6-hydroxy-4-oxo-1H-quinoline-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 6-Hydroxykynurenic acid (6-HKA) is a derivative of kynurenic acid (KYNA) and can be isolated from Ginkgo leaves. 6-Hydroxykynurenic acid is a low-affinity NMDAR antagonist (IC50: 59 μM)[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50: 59 μM (NMDAR)[1] |
| References |
| Density | 1.569g/cm3 |
|---|---|
| Boiling Point | 455.6ºC at 760mmHg |
| Molecular Formula | C10H7NO4 |
| Molecular Weight | 205.16700 |
| Flash Point | 229.4ºC |
| Exact Mass | 205.03800 |
| PSA | 90.39000 |
| LogP | 0.93190 |
| Index of Refraction | 1.681 |
| InChIKey | CQUUHDQRJWXDPY-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(=O)c2cc(O)ccc2[nH]1 |
| HS Code | 2933499090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-Hydroxykynurenic acid |
| 4,6-dihydroxy-2-carboxyquinoline |
| 6-Hydroxykynureninsaeure |
| 4,6-dihydroxy-quinoline-2-carboxylic acid |
| Quinaldic acid,4,6-dihydroxy |
| 6-Hydroxykynurensaeure |
| 6-Hydroxykynurenate |
| 4,6-Dihydroxyquinaldic acid |
| 4,6-Dihydroxy-chinolin-2-carbonsaeure |