4-Chloro-1,1,2-trifluoro-1-butene structure
|
Common Name | 4-Chloro-1,1,2-trifluoro-1-butene | ||
|---|---|---|---|---|
| CAS Number | 378-81-4 | Molecular Weight | 144.52300 | |
| Density | 1.251g/cm3 | Boiling Point | 87.9ºC at 760mmHg | |
| Molecular Formula | C4H4ClF3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 16.7ºC | |
| Name | 4-Chloro-1,1,2-trifluoro-1-butene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.251g/cm3 |
|---|---|
| Boiling Point | 87.9ºC at 760mmHg |
| Molecular Formula | C4H4ClF3 |
| Molecular Weight | 144.52300 |
| Flash Point | 16.7ºC |
| Exact Mass | 143.99500 |
| LogP | 2.69290 |
| Index of Refraction | 1.362 |
| InChIKey | AARHFRMJZTZXLE-UHFFFAOYSA-N |
| SMILES | FC(F)=C(F)C(F)(F)C(F)(F)Cl |
| Hazard Codes | Xi: Irritant;F: Flammable; |
|---|---|
| Risk Phrases | R10 |
| Safety Phrases | 16 |
| RIDADR | UN 1993 |
| HS Code | 2903799090 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2903799090 |
|---|---|
| Summary | 2903799090 halogenated derivatives of acyclic hydrocarbons containing two or more different halogens。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 4-CHLORO-1,1,2-TRIFLUOROBUTENE-1 |
| 4-chloro-heptafluoro-but-1-ene |
| 4-Chlor-heptafluor-1-buten |
| heptafluorohomoallyl chloride |
| 4-chloro-1,1,2,3,3,4,4-heptafluoro-but-1-ene |
| 4-chloroheptafluoro-1-butene |
| 4-Chlor-heptafluor-but-1-en |
| 4-CHLORO-1,1,2-TRIFLUOROBUT-1-ENE |