2-chloro-N-[2-(trifluoromethyl)phenyl]acetamide structure
|
Common Name | 2-chloro-N-[2-(trifluoromethyl)phenyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 3792-04-9 | Molecular Weight | 237.60600 | |
| Density | 1.289g/cm3 | Boiling Point | 205ºC at 760mmHg | |
| Molecular Formula | C9H7ClF3NO | Melting Point | 92-94°C | |
| MSDS | N/A | Flash Point | 85ºC | |
| Name | 2-chloro-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.289g/cm3 |
|---|---|
| Boiling Point | 205ºC at 760mmHg |
| Melting Point | 92-94°C |
| Molecular Formula | C9H7ClF3NO |
| Molecular Weight | 237.60600 |
| Flash Point | 85ºC |
| Exact Mass | 237.01700 |
| PSA | 29.10000 |
| LogP | 2.95570 |
| Index of Refraction | 1.513 |
| InChIKey | GCSXEMRXTRHXIS-UHFFFAOYSA-N |
| SMILES | O=C(CCl)Nc1ccccc1C(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | S26-S36 |
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD00018893 |
| chloro-acetic acid-(2-trifluoromethyl-anilide) |
| F0266-3216 |
| N-(Chloroacetyl)-2-(Trifluoromethyl)Aniline |
| [(2-trifluoromethylphenyl)aminocarbonylmethyl]chloride |
| 2-chloro-N-(2-trifluoromethylphenyl)-acetamide |