Nonadecafluorodecanenitrile structure
|
Common Name | Nonadecafluorodecanenitrile | ||
|---|---|---|---|---|
| CAS Number | 379215-40-4 | Molecular Weight | 495.08300 | |
| Density | 1.701 g/cm3 | Boiling Point | 160.6ºC at 760 mmHg | |
| Molecular Formula | C10F19N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 50.9ºC | |
| Name | Perfluorodecanonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.701 g/cm3 |
|---|---|
| Boiling Point | 160.6ºC at 760 mmHg |
| Molecular Formula | C10F19N |
| Molecular Weight | 495.08300 |
| Flash Point | 50.9ºC |
| Exact Mass | 494.97300 |
| PSA | 23.79000 |
| LogP | 6.15468 |
| Index of Refraction | 1.28 |
| InChIKey | QXBUHLMUCFBZOL-UHFFFAOYSA-N |
| SMILES | N#CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36/37/39 |
|
~%
Nonadecafluorod... CAS#:379215-40-4 |
| Literature: Minnesota Mining and Mfg.Co. Patent: US2593737 , 1949 ; DRP/DRBP Org.Chem. Full Text Show Details Minnesota Mining and Mfg.Co. Patent: DE836796 , 1949 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecanenitrile |